C24H28N6O5S — CID 166958395
N-[(3E,5E)-5-[[3-(3,5-dimethoxyphenyl)-1-methyl-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]hepta-1,3,5-trien-4-yl]ethenesulfonamide (PubChem CID 166958395) has the molecular formula C24H28N6O5S and a molecular weight of 512.59 g/mol. Its IUPAC name is N-[(3E,5E)-5-[[3-(3,5-dimethoxyphenyl)-1-methyl-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]hepta-1,3,5-trien-4-yl]ethenesulfonamide.
| Compound Name | N-[(3E,5E)-5-[[3-(3,5-dimethoxyphenyl)-1-methyl-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]hepta-1,3,5-trien-4-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 166958395 |
| Molecular Formula | C24H28N6O5S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | N-[(3E,5E)-5-[[3-(3,5-dimethoxyphenyl)-1-methyl-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]hepta-1,3,5-trien-4-yl]ethenesulfonamide |
| SMILES | C=C/C=C(NS(=O)(=O)C=C)\C(=C/C)Nc1ncc2c(n1)N(C)C(=O)N(c1cc(OC)cc(OC)c1)C2 |
| InChI | InChI=1S/C24H28N6O5S/c1-7-10-21(28-36(32,33)9-3)20(8-2)26-23-25-14-16-15-30(24(31)29(4)22(16)27-23)17-11-18(34-5)13-19(12-17)35-6/h7-14,28H,1,3,15H2,2,4-6H3,(H,25,26,27)/b20-8+,21-10+ |
| InChIKey | DCPSUGINPSYKOH-GTGODNQPSA-N |
| XLogP | 3.52 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|