About 6-(2,2-dimethylpropyl)-1,3-dimethylindazole
6-(2,2-dimethylpropyl)-1,3-dimethylindazole (PubChem CID 166958458) has the molecular formula C14H20N2
and a molecular weight of 216.33 g/mol. Its IUPAC name is 6-(2,2-dimethylpropyl)-1,3-dimethylindazole.
Molecular Properties
| Compound Name | 6-(2,2-dimethylpropyl)-1,3-dimethylindazole |
| PubChem CID | 166958458 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 6-(2,2-dimethylpropyl)-1,3-dimethylindazole |
| SMILES | Cc1nn(C)c2cc(CC(C)(C)C)ccc12 |
| InChI | InChI=1S/C14H20N2/c1-10-12-7-6-11(9-14(2,3)4)8-13(12)16(5)15-10/h6-8H,9H2,1-5H3 |
| InChIKey | QKCPDPDCZFMSNZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2,2-dimethylpropyl)-1,3-dimethylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-dimethylpropyl)-1,3-dimethylindazole?
The IUPAC name of 6-(2,2-dimethylpropyl)-1,3-dimethylindazole (CID 166958458) is 6-(2,2-dimethylpropyl)-1,3-dimethylindazole.
What is the SMILES notation for 6-(2,2-dimethylpropyl)-1,3-dimethylindazole?
The canonical SMILES for 6-(2,2-dimethylpropyl)-1,3-dimethylindazole is Cc1nn(C)c2cc(CC(C)(C)C)ccc12.
What is the InChIKey of 6-(2,2-dimethylpropyl)-1,3-dimethylindazole?
The InChIKey is QKCPDPDCZFMSNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2/c1-10-12-7-6-11(9-14(2,3)4)8-13(12)16(5)15-10/h6-8H,9H2,1-5H3.
What are the key properties of 6-(2,2-dimethylpropyl)-1,3-dimethylindazole?
6-(2,2-dimethylpropyl)-1,3-dimethylindazole has a molecular weight of 216.33 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-dimethylpropyl)-1,3-dimethylindazole is sourced from PubChem (CID 166958458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).