C18H15F5N2O3 — CID 166958607
1-[(5,6-difluoro-1H-indol-3-yl)amino]-2-[4-(trifluoromethoxy)phenoxy]propan-1-ol (PubChem CID 166958607) has the molecular formula C18H15F5N2O3 and a molecular weight of 402.32 g/mol. Its IUPAC name is 1-[(5,6-difluoro-1H-indol-3-yl)amino]-2-[4-(trifluoromethoxy)phenoxy]propan-1-ol.
| Compound Name | 1-[(5,6-difluoro-1H-indol-3-yl)amino]-2-[4-(trifluoromethoxy)phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 166958607 |
| Molecular Formula | C18H15F5N2O3 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 1-[(5,6-difluoro-1H-indol-3-yl)amino]-2-[4-(trifluoromethoxy)phenoxy]propan-1-ol |
| SMILES | CC(Oc1ccc(OC(F)(F)F)cc1)C(O)Nc1c[nH]c2cc(F)c(F)cc12 |
| InChI | InChI=1S/C18H15F5N2O3/c1-9(27-10-2-4-11(5-3-10)28-18(21,22)23)17(26)25-16-8-24-15-7-14(20)13(19)6-12(15)16/h2-9,17,24-26H,1H3 |
| InChIKey | HFMCTILIXXYAKA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|