About 5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile
5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile (PubChem CID 166958634) has the molecular formula C19H16N4S
and a molecular weight of 332.43 g/mol. Its IUPAC name is 5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile.
Molecular Properties
| Compound Name | 5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile |
| PubChem CID | 166958634 |
| Molecular Formula | C19H16N4S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile |
| SMILES | CC(C)(C)Sc1ccncc1-c1ccc(C#N)c2cc(C#N)cn12 |
| InChI | InChI=1S/C19H16N4S/c1-19(2,3)24-18-6-7-22-11-15(18)16-5-4-14(10-21)17-8-13(9-20)12-23(16)17/h4-8,11-12H,1-3H3 |
| InChIKey | FLSLVYQFDVNNJM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile?
The IUPAC name of 5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile (CID 166958634) is 5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile.
What is the SMILES notation for 5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile?
The canonical SMILES for 5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile is CC(C)(C)Sc1ccncc1-c1ccc(C#N)c2cc(C#N)cn12.
What is the InChIKey of 5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile?
The InChIKey is FLSLVYQFDVNNJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4S/c1-19(2,3)24-18-6-7-22-11-15(18)16-5-4-14(10-21)17-8-13(9-20)12-23(16)17/h4-8,11-12H,1-3H3.
What are the key properties of 5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile?
5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile has a molecular weight of 332.43 g/mol, XLogP of 4.64, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-tert-butylsulfanyl-3-pyridinyl)indolizine-2,8-dicarbonitrile is sourced from PubChem (CID 166958634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).