About (1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine
(1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine (PubChem CID 166959090) has the molecular formula C16H21N
and a molecular weight of 227.35 g/mol. Its IUPAC name is (1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine.
Molecular Properties
| Compound Name | (1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine |
| PubChem CID | 166959090 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine |
| SMILES | [H]N=C(/C=C1/CC2CC(C1=C)C2(C)C)C(=C)C=C |
| InChI | InChI=1S/C16H21N/c1-6-10(2)15(17)8-12-7-13-9-14(11(12)3)16(13,4)5/h6,8,13-14,17H,1-3,7,9H2,4-5H3/b12-8-,17-15- |
| InChIKey | XMEPUEFFGDCNPY-LVFICAAZSA-N |
| XLogP | 4.30 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine?
The IUPAC name of (1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine (CID 166959090) is (1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine.
What is the SMILES notation for (1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine?
The canonical SMILES for (1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine is [H]N=C(/C=C1/CC2CC(C1=C)C2(C)C)C(=C)C=C.
What is the InChIKey of (1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine?
The InChIKey is XMEPUEFFGDCNPY-LVFICAAZSA-N. The full InChI is InChI=1S/C16H21N/c1-6-10(2)15(17)8-12-7-13-9-14(11(12)3)16(13,4)5/h6,8,13-14,17H,1-3,7,9H2,4-5H3/b12-8-,17-15-.
What are the key properties of (1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine?
(1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine has a molecular weight of 227.35 g/mol, XLogP of 4.30, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)-3-methylidenepent-4-en-2-imine is sourced from PubChem (CID 166959090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).