C14H18N2 — CID 166959142
(3Z)-5-[(1Z)-buta-1,3-dienyl]imino-N-ethenyl-N-methylhepta-1,3,6-trien-4-amine (PubChem CID 166959142) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (3Z)-5-[(1Z)-buta-1,3-dienyl]imino-N-ethenyl-N-methylhepta-1,3,6-trien-4-amine.
| Compound Name | (3Z)-5-[(1Z)-buta-1,3-dienyl]imino-N-ethenyl-N-methylhepta-1,3,6-trien-4-amine |
|---|---|
| PubChem CID | 166959142 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (3Z)-5-[(1Z)-buta-1,3-dienyl]imino-N-ethenyl-N-methylhepta-1,3,6-trien-4-amine |
| SMILES | C=C/C=C\N=C(C=C)\C(=C\C=C)N(C)C=C |
| InChI | InChI=1S/C14H18N2/c1-6-10-12-15-13(8-3)14(11-7-2)16(5)9-4/h6-12H,1-4H2,5H3/b12-10-,14-11-,15-13+ |
| InChIKey | DLZLSMPJOGOMPI-VQGLWSBPSA-N |
| XLogP | 3.46 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|