C21H30ClN3O5 — CID 166959284
ethyl 8-tert-butyl-3-chloro-4-(3-methoxypropoxy)-12-oxo-5,6,9-triazatricyclo[7.4.0.02,6]trideca-2,4,10-triene-11-carboxylate (PubChem CID 166959284) has the molecular formula C21H30ClN3O5 and a molecular weight of 439.94 g/mol. Its IUPAC name is ethyl 8-tert-butyl-3-chloro-4-(3-methoxypropoxy)-12-oxo-5,6,9-triazatricyclo[7.4.0.02,6]trideca-2,4,10-triene-11-carboxylate.
| Compound Name | ethyl 8-tert-butyl-3-chloro-4-(3-methoxypropoxy)-12-oxo-5,6,9-triazatricyclo[7.4.0.02,6]trideca-2,4,10-triene-11-carboxylate |
|---|---|
| PubChem CID | 166959284 |
| Molecular Formula | C21H30ClN3O5 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | ethyl 8-tert-butyl-3-chloro-4-(3-methoxypropoxy)-12-oxo-5,6,9-triazatricyclo[7.4.0.02,6]trideca-2,4,10-triene-11-carboxylate |
| SMILES | CCOC(=O)C1=CN2C(CC1=O)c1c(Cl)c(OCCCOC)nn1CC2C(C)(C)C |
| InChI | InChI=1S/C21H30ClN3O5/c1-6-29-20(27)13-11-24-14(10-15(13)26)18-17(22)19(30-9-7-8-28-5)23-25(18)12-16(24)21(2,3)4/h11,14,16H,6-10,12H2,1-5H3 |
| InChIKey | LLOSPRFJHZZUCI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|