C11H21N — CID 166959719
(3S,3aR,4R,7S,7aR)-3,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-amine (PubChem CID 166959719) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (3S,3aR,4R,7S,7aR)-3,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-amine.
| Compound Name | (3S,3aR,4R,7S,7aR)-3,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 166959719 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (3S,3aR,4R,7S,7aR)-3,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-amine |
| SMILES | C[C@H]1CC[C@@H](N)[C@H]2[C@@H]1CC[C@@H]2C |
| InChI | InChI=1S/C11H21N/c1-7-4-6-10(12)11-8(2)3-5-9(7)11/h7-11H,3-6,12H2,1-2H3/t7-,8-,9+,10+,11+/m0/s1 |
| InChIKey | IJJBSAIAWAJUQV-FBDQPXRJSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |