C25H24N2O4 — CID 166959954
1-hydroxy-1-phenyl-7-phenylmethoxy-2,3,4,4a,5,11a-hexahydropyrido[1,2-a]quinoxaline-6,8-dione (PubChem CID 166959954) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 1-hydroxy-1-phenyl-7-phenylmethoxy-2,3,4,4a,5,11a-hexahydropyrido[1,2-a]quinoxaline-6,8-dione.
| Compound Name | 1-hydroxy-1-phenyl-7-phenylmethoxy-2,3,4,4a,5,11a-hexahydropyrido[1,2-a]quinoxaline-6,8-dione |
|---|---|
| PubChem CID | 166959954 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-hydroxy-1-phenyl-7-phenylmethoxy-2,3,4,4a,5,11a-hexahydropyrido[1,2-a]quinoxaline-6,8-dione |
| SMILES | O=C1NC2CCCC(O)(c3ccccc3)C2n2ccc(=O)c(OCc3ccccc3)c21 |
| InChI | InChI=1S/C25H24N2O4/c28-20-13-15-27-21(22(20)31-16-17-8-3-1-4-9-17)24(29)26-19-12-7-14-25(30,23(19)27)18-10-5-2-6-11-18/h1-6,8-11,13,15,19,23,30H,7,12,14,16H2,(H,26,29) |
| InChIKey | UMZSCHHRJMIVFN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |