C16H19N3O3 — CID 166960476
3-[2-methyl-6-oxo-4,5-bis[(Z)-prop-1-enyl]pyrimidin-1-yl]piperidine-2,6-dione (PubChem CID 166960476) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-[2-methyl-6-oxo-4,5-bis[(Z)-prop-1-enyl]pyrimidin-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-methyl-6-oxo-4,5-bis[(Z)-prop-1-enyl]pyrimidin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166960476 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-[2-methyl-6-oxo-4,5-bis[(Z)-prop-1-enyl]pyrimidin-1-yl]piperidine-2,6-dione |
| SMILES | C/C=C\c1nc(C)n(C2CCC(=O)NC2=O)c(=O)c1/C=C\C |
| InChI | InChI=1S/C16H19N3O3/c1-4-6-11-12(7-5-2)17-10(3)19(16(11)22)13-8-9-14(20)18-15(13)21/h4-7,13H,8-9H2,1-3H3,(H,18,20,21)/b6-4-,7-5- |
| InChIKey | AMLDEZVYNRTNKH-PEPZGXQESA-N |
| XLogP | 1.60 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|