C18H33F2NO — CID 166960836
3-[(2,4-difluorocyclohexyl)methyl]-N-(oxolan-2-ylmethyl)hexan-1-amine (PubChem CID 166960836) has the molecular formula C18H33F2NO and a molecular weight of 317.46 g/mol. Its IUPAC name is 3-[(2,4-difluorocyclohexyl)methyl]-N-(oxolan-2-ylmethyl)hexan-1-amine.
| Compound Name | 3-[(2,4-difluorocyclohexyl)methyl]-N-(oxolan-2-ylmethyl)hexan-1-amine |
|---|---|
| PubChem CID | 166960836 |
| Molecular Formula | C18H33F2NO |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 3-[(2,4-difluorocyclohexyl)methyl]-N-(oxolan-2-ylmethyl)hexan-1-amine |
| SMILES | CCCC(CCNCC1CCCO1)CC1CCC(F)CC1F |
| InChI | InChI=1S/C18H33F2NO/c1-2-4-14(8-9-21-13-17-5-3-10-22-17)11-15-6-7-16(19)12-18(15)20/h14-18,21H,2-13H2,1H3 |
| InChIKey | HZBJZLKMFCSIQI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|