C15H10BrF4N3 — CID 166961843
3-(6-bromo-4-fluoro-2-pyridinyl)-6-(1,1,1-trifluoropropan-2-yl)imidazo[1,2-a]pyridine (PubChem CID 166961843) has the molecular formula C15H10BrF4N3 and a molecular weight of 388.16 g/mol. Its IUPAC name is 3-(6-bromo-4-fluoro-2-pyridinyl)-6-(1,1,1-trifluoropropan-2-yl)imidazo[1,2-a]pyridine.
| Compound Name | 3-(6-bromo-4-fluoro-2-pyridinyl)-6-(1,1,1-trifluoropropan-2-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 166961843 |
| Molecular Formula | C15H10BrF4N3 |
| Molecular Weight | 388.16 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 3-(6-bromo-4-fluoro-2-pyridinyl)-6-(1,1,1-trifluoropropan-2-yl)imidazo[1,2-a]pyridine |
| SMILES | CC(c1ccc2ncc(-c3cc(F)cc(Br)n3)n2c1)C(F)(F)F |
| InChI | InChI=1S/C15H10BrF4N3/c1-8(15(18,19)20)9-2-3-14-21-6-12(23(14)7-9)11-4-10(17)5-13(16)22-11/h2-8H,1H3 |
| InChIKey | ZNUUXIAIALQUFE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.16 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|