About 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea
1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 166962842) has the molecular formula C17H16FN5O2S
and a molecular weight of 373.41 g/mol. Its IUPAC name is 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea |
| PubChem CID | 166962842 |
| Molecular Formula | C17H16FN5O2S |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CC(C)Oc1ccc(NC(=O)Nc2nnc(-c3cccnc3)s2)c(F)c1 |
| InChI | InChI=1S/C17H16FN5O2S/c1-10(2)25-12-5-6-14(13(18)8-12)20-16(24)21-17-23-22-15(26-17)11-4-3-7-19-9-11/h3-10H,1-2H3,(H2,20,21,23,24) |
| InChIKey | ASBGGZOUABDAPL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea?
The IUPAC name of 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea (CID 166962842) is 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea.
What is the SMILES notation for 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea?
The canonical SMILES for 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea is CC(C)Oc1ccc(NC(=O)Nc2nnc(-c3cccnc3)s2)c(F)c1.
What is the InChIKey of 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea?
The InChIKey is ASBGGZOUABDAPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FN5O2S/c1-10(2)25-12-5-6-14(13(18)8-12)20-16(24)21-17-23-22-15(26-17)11-4-3-7-19-9-11/h3-10H,1-2H3,(H2,20,21,23,24).
What are the key properties of 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea?
1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea has a molecular weight of 373.41 g/mol, XLogP of 4.17, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)urea is sourced from PubChem (CID 166962842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).