C35H71NO — CID 166963240
N-[2-[(E)-4,4-dimethyldocos-13-en-2-yl]oxy-2-methylpropyl]-3,3-dimethylpentan-1-amine (PubChem CID 166963240) has the molecular formula C35H71NO and a molecular weight of 521.96 g/mol. Its IUPAC name is N-[2-[(E)-4,4-dimethyldocos-13-en-2-yl]oxy-2-methylpropyl]-3,3-dimethylpentan-1-amine.
| Compound Name | N-[2-[(E)-4,4-dimethyldocos-13-en-2-yl]oxy-2-methylpropyl]-3,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 166963240 |
| Molecular Formula | C35H71NO |
| Molecular Weight | 521.96 g/mol |
| Exact Mass | 521.55 |
| IUPAC Name | N-[2-[(E)-4,4-dimethyldocos-13-en-2-yl]oxy-2-methylpropyl]-3,3-dimethylpentan-1-amine |
| SMILES | CCCCCCCC/C=C/CCCCCCCCC(C)(C)CC(C)OC(C)(C)CNCCC(C)(C)CC |
| InChI | InChI=1S/C35H71NO/c1-10-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-34(6,7)30-32(3)37-35(8,9)31-36-29-28-33(4,5)11-2/h18-19,32,36H,10-17,20-31H2,1-9H3/b19-18+ |
| InChIKey | DQYUJLBKSVHXFW-VHEBQXMUSA-N |
| XLogP | 11.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.96 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|