About 6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid
6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid (PubChem CID 166963294) has the molecular formula C20H21Cl2N3O4
and a molecular weight of 438.31 g/mol. Its IUPAC name is 6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid.
Molecular Properties
| Compound Name | 6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid |
| PubChem CID | 166963294 |
| Molecular Formula | C20H21Cl2N3O4 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid |
| SMILES | Cc1nc(N2CCC3(CCCO3)CC2)c(C(=O)OO)nc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H21Cl2N3O4/c1-12-16(13-4-2-5-14(21)15(13)22)24-17(19(26)29-27)18(23-12)25-9-7-20(8-10-25)6-3-11-28-20/h2,4-5,27H,3,6-11H2,1H3 |
| InChIKey | CZWZQTXUXWSMNV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid?
The IUPAC name of 6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid (CID 166963294) is 6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid.
What is the SMILES notation for 6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid?
The canonical SMILES for 6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid is Cc1nc(N2CCC3(CCCO3)CC2)c(C(=O)OO)nc1-c1cccc(Cl)c1Cl.
What is the InChIKey of 6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid?
The InChIKey is CZWZQTXUXWSMNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21Cl2N3O4/c1-12-16(13-4-2-5-14(21)15(13)22)24-17(19(26)29-27)18(23-12)25-9-7-20(8-10-25)6-3-11-28-20/h2,4-5,27H,3,6-11H2,1H3.
What are the key properties of 6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid?
6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid has a molecular weight of 438.31 g/mol, XLogP of 4.54, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dichlorophenyl)-5-methyl-3-(1-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboperoxoic acid is sourced from PubChem (CID 166963294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).