C13H16F3N — CID 166963371
3-methyl-6-[(3E,5E)-2,6,7-trifluorohepta-1,3,5-trien-4-yl]-2,3,4,5-tetrahydropyridine (PubChem CID 166963371) has the molecular formula C13H16F3N and a molecular weight of 243.27 g/mol. Its IUPAC name is 3-methyl-6-[(3E,5E)-2,6,7-trifluorohepta-1,3,5-trien-4-yl]-2,3,4,5-tetrahydropyridine.
| Compound Name | 3-methyl-6-[(3E,5E)-2,6,7-trifluorohepta-1,3,5-trien-4-yl]-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 166963371 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3-methyl-6-[(3E,5E)-2,6,7-trifluorohepta-1,3,5-trien-4-yl]-2,3,4,5-tetrahydropyridine |
| SMILES | C=C(F)/C=C(\C=C(\F)CF)C1=NCC(C)CC1 |
| InChI | InChI=1S/C13H16F3N/c1-9-3-4-13(17-8-9)11(5-10(2)15)6-12(16)7-14/h5-6,9H,2-4,7-8H2,1H3/b11-5+,12-6+ |
| InChIKey | MZSIFLDLQROVBG-YDWXAUTNSA-N |
| XLogP | 4.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|