About 2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine
2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine (PubChem CID 166963414) has the molecular formula C12H18FN
and a molecular weight of 195.28 g/mol. Its IUPAC name is 2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine.
Molecular Properties
| Compound Name | 2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine |
| PubChem CID | 166963414 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine |
| SMILES | CC1CCC(C2C=C(F)C=CC2)NC1 |
| InChI | InChI=1S/C12H18FN/c1-9-5-6-12(14-8-9)10-3-2-4-11(13)7-10/h2,4,7,9-10,12,14H,3,5-6,8H2,1H3 |
| InChIKey | CLJFQDMLXCFITG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine?
The IUPAC name of 2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine (CID 166963414) is 2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine.
What is the SMILES notation for 2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine?
The canonical SMILES for 2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine is CC1CCC(C2C=C(F)C=CC2)NC1.
What is the InChIKey of 2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine?
The InChIKey is CLJFQDMLXCFITG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FN/c1-9-5-6-12(14-8-9)10-3-2-4-11(13)7-10/h2,4,7,9-10,12,14H,3,5-6,8H2,1H3.
What are the key properties of 2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine?
2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine has a molecular weight of 195.28 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluorocyclohexa-2,4-dien-1-yl)-5-methylpiperidine is sourced from PubChem (CID 166963414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).