C8H11NS — CID 166963431
(4R,5Z,7Z)-4-methyl-4,9-dihydro-1,3-thiazonine (PubChem CID 166963431) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is (4R,5Z,7Z)-4-methyl-4,9-dihydro-1,3-thiazonine.
| Compound Name | (4R,5Z,7Z)-4-methyl-4,9-dihydro-1,3-thiazonine |
|---|---|
| PubChem CID | 166963431 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | (4R,5Z,7Z)-4-methyl-4,9-dihydro-1,3-thiazonine |
| SMILES | C[C@@H]1/C=C\C=C/CS/C=N\1 |
| InChI | InChI=1S/C8H11NS/c1-8-5-3-2-4-6-10-7-9-8/h2-5,7-8H,6H2,1H3/b4-2-,5-3-,9-7-/t8-/m1/s1 |
| InChIKey | LHAFOIQLAOJWCC-SUNRURGOSA-N |
| XLogP | 2.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |