About 6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine
6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine (PubChem CID 166963522) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is 6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine.
Molecular Properties
| Compound Name | 6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine |
| PubChem CID | 166963522 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine |
| SMILES | C=C1CC=C(C)N(C(=C)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H21NO/c1-10-7-8-11(2)14(9-10)12(3)15-13(4,5)6/h8H,1,3,7,9H2,2,4-6H3 |
| InChIKey | CHTGATMDVIZPJT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine?
The IUPAC name of 6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine (CID 166963522) is 6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine.
What is the SMILES notation for 6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine?
The canonical SMILES for 6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine is C=C1CC=C(C)N(C(=C)OC(C)(C)C)C1.
What is the InChIKey of 6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine?
The InChIKey is CHTGATMDVIZPJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c1-10-7-8-11(2)14(9-10)12(3)15-13(4,5)6/h8H,1,3,7,9H2,2,4-6H3.
What are the key properties of 6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine?
6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine has a molecular weight of 207.32 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-methylidene-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2,4-dihydropyridine is sourced from PubChem (CID 166963522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).