About 3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one
3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one (PubChem CID 166963863) has the molecular formula C8H17FN2O
and a molecular weight of 176.23 g/mol. Its IUPAC name is 3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one.
Molecular Properties
| Compound Name | 3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one |
| PubChem CID | 166963863 |
| Molecular Formula | C8H17FN2O |
| Molecular Weight | 176.23 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one |
| SMILES | CC(=O)C(N)C(C)(F)C(C)(C)N |
| InChI | InChI=1S/C8H17FN2O/c1-5(12)6(10)8(4,9)7(2,3)11/h6H,10-11H2,1-4H3 |
| InChIKey | LQYPRLJDKBEVGC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one?
The IUPAC name of 3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one (CID 166963863) is 3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one.
What is the SMILES notation for 3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one?
The canonical SMILES for 3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one is CC(=O)C(N)C(C)(F)C(C)(C)N.
What is the InChIKey of 3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one?
The InChIKey is LQYPRLJDKBEVGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17FN2O/c1-5(12)6(10)8(4,9)7(2,3)11/h6H,10-11H2,1-4H3.
What are the key properties of 3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one?
3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one has a molecular weight of 176.23 g/mol, XLogP of 0.37, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diamino-4-fluoro-4,5-dimethylhexan-2-one is sourced from PubChem (CID 166963863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).