About 3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one
3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one (PubChem CID 166963871) has the molecular formula C10H20FNO
and a molecular weight of 189.27 g/mol. Its IUPAC name is 3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one.
Molecular Properties
| Compound Name | 3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one |
| PubChem CID | 166963871 |
| Molecular Formula | C10H20FNO |
| Molecular Weight | 189.27 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one |
| SMILES | CNC(C)C(C)(C)C(C)(F)C(C)=O |
| InChI | InChI=1S/C10H20FNO/c1-7(12-6)9(3,4)10(5,11)8(2)13/h7,12H,1-6H3 |
| InChIKey | HNBFHEITFZJESW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one?
The IUPAC name of 3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one (CID 166963871) is 3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one.
What is the SMILES notation for 3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one?
The canonical SMILES for 3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one is CNC(C)C(C)(C)C(C)(F)C(C)=O.
What is the InChIKey of 3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one?
The InChIKey is HNBFHEITFZJESW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20FNO/c1-7(12-6)9(3,4)10(5,11)8(2)13/h7,12H,1-6H3.
What are the key properties of 3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one?
3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one has a molecular weight of 189.27 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-3,4,4-trimethyl-5-(methylamino)hexan-2-one is sourced from PubChem (CID 166963871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).