C14H18O4 — CID 166964017
(1S,4S,7S,11R)-7-[(1E,3E)-hexa-1,3,5-trienyl]-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol (PubChem CID 166964017) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (1S,4S,7S,11R)-7-[(1E,3E)-hexa-1,3,5-trienyl]-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol.
| Compound Name | (1S,4S,7S,11R)-7-[(1E,3E)-hexa-1,3,5-trienyl]-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol |
|---|---|
| PubChem CID | 166964017 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (1S,4S,7S,11R)-7-[(1E,3E)-hexa-1,3,5-trienyl]-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol |
| SMILES | C=C/C=C/C=C/[C@]12OCC[C@@H]3OC[C@](O)(CO1)[C@@H]32 |
| InChI | InChI=1S/C14H18O4/c1-2-3-4-5-7-14-12-11(6-8-17-14)16-9-13(12,15)10-18-14/h2-5,7,11-12,15H,1,6,8-10H2/b4-3+,7-5+/t11-,12+,13-,14-/m0/s1 |
| InChIKey | RRSVAHVXRYWKIM-AXYSIPPYSA-N |
| XLogP | 1.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|