C26H32O2 — CID 166964055
1-methyl-3-[(4E,6Z,8E)-12-(4-methylphenoxy)dodeca-4,6,8-trienoxy]benzene (PubChem CID 166964055) has the molecular formula C26H32O2 and a molecular weight of 376.54 g/mol. Its IUPAC name is 1-methyl-3-[(4E,6Z,8E)-12-(4-methylphenoxy)dodeca-4,6,8-trienoxy]benzene.
| Compound Name | 1-methyl-3-[(4E,6Z,8E)-12-(4-methylphenoxy)dodeca-4,6,8-trienoxy]benzene |
|---|---|
| PubChem CID | 166964055 |
| Molecular Formula | C26H32O2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 1-methyl-3-[(4E,6Z,8E)-12-(4-methylphenoxy)dodeca-4,6,8-trienoxy]benzene |
| SMILES | Cc1ccc(OCCC/C=C/C=C\C=C\CCCOc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C26H32O2/c1-23-16-18-25(19-17-23)27-20-11-9-7-5-3-4-6-8-10-12-21-28-26-15-13-14-24(2)22-26/h3-8,13-19,22H,9-12,20-21H2,1-2H3/b4-3-,7-5+,8-6+ |
| InChIKey | MIIQRZIXGDILQT-MBAZBMQQSA-N |
| XLogP | 6.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|