About [triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate
[triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate (PubChem CID 16696457) has the molecular formula C30H23N2O4Sb
and a molecular weight of 597.28 g/mol. Its IUPAC name is [triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate.
Molecular Properties
| Compound Name | [triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate |
| PubChem CID | 16696457 |
| Molecular Formula | C30H23N2O4Sb |
| Molecular Weight | 597.28 g/mol |
| Exact Mass | 596.07 |
| IUPAC Name | [triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate |
| SMILES | O=C(O[Sb](OC(=O)c1cccnc1)(c1ccccc1)(c1ccccc1)c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/2C6H5NO2.3C6H5.Sb/c2*8-6(9)5-2-1-3-7-4-5;3*1-2-4-6-5-3-1;/h2*1-4H,(H,8,9);3*1-5H;/q;;;;;+2/p-2 |
| InChIKey | CSXMGJYADYCRIZ-UHFFFAOYSA-L |
| XLogP | 3.61 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 597.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate?
The IUPAC name of [triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate (CID 16696457) is [triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate.
What is the SMILES notation for [triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate?
The canonical SMILES for [triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate is O=C(O[Sb](OC(=O)c1cccnc1)(c1ccccc1)(c1ccccc1)c1ccccc1)c1cccnc1.
What is the InChIKey of [triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate?
The InChIKey is CSXMGJYADYCRIZ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H5NO2.3C6H5.Sb/c2*8-6(9)5-2-1-3-7-4-5;3*1-2-4-6-5-3-1;/h2*1-4H,(H,8,9);3*1-5H;/q;;;;;+2/p-2.
What are the key properties of [triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate?
[triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate has a molecular weight of 597.28 g/mol, XLogP of 3.61, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [triphenyl(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate is sourced from PubChem (CID 16696457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).