C24H27FN2O — CID 166964989
2-benzyl-N-(8-fluoroquinolin-3-yl)-2,4,4-trimethylpentanamide (PubChem CID 166964989) has the molecular formula C24H27FN2O and a molecular weight of 378.49 g/mol. Its IUPAC name is 2-benzyl-N-(8-fluoroquinolin-3-yl)-2,4,4-trimethylpentanamide.
| Compound Name | 2-benzyl-N-(8-fluoroquinolin-3-yl)-2,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 166964989 |
| Molecular Formula | C24H27FN2O |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 2-benzyl-N-(8-fluoroquinolin-3-yl)-2,4,4-trimethylpentanamide |
| SMILES | CC(C)(C)CC(C)(Cc1ccccc1)C(=O)Nc1cnc2c(F)cccc2c1 |
| InChI | InChI=1S/C24H27FN2O/c1-23(2,3)16-24(4,14-17-9-6-5-7-10-17)22(28)27-19-13-18-11-8-12-20(25)21(18)26-15-19/h5-13,15H,14,16H2,1-4H3,(H,27,28) |
| InChIKey | WAJZWWIAWPHHPZ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |