C21H34N2 — CID 166965996
(9Z)-N-methyl-8-methylidene-5-[(3Z)-penta-1,3-dien-2-yl]-4-(propan-2-ylideneamino)undeca-1,9-dien-2-amine (PubChem CID 166965996) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is (9Z)-N-methyl-8-methylidene-5-[(3Z)-penta-1,3-dien-2-yl]-4-(propan-2-ylideneamino)undeca-1,9-dien-2-amine.
| Compound Name | (9Z)-N-methyl-8-methylidene-5-[(3Z)-penta-1,3-dien-2-yl]-4-(propan-2-ylideneamino)undeca-1,9-dien-2-amine |
|---|---|
| PubChem CID | 166965996 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | (9Z)-N-methyl-8-methylidene-5-[(3Z)-penta-1,3-dien-2-yl]-4-(propan-2-ylideneamino)undeca-1,9-dien-2-amine |
| SMILES | C=C(/C=C\C)CCC(C(=C)/C=C\C)C(CC(=C)NC)N=C(C)C |
| InChI | InChI=1S/C21H34N2/c1-9-11-17(5)13-14-20(18(6)12-10-2)21(23-16(3)4)15-19(7)22-8/h9-12,20-22H,5-7,13-15H2,1-4,8H3/b11-9-,12-10- |
| InChIKey | DHEPMBWSJBXYBC-HWAYABPNSA-N |
| XLogP | 5.62 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|