C22H36N2 — CID 166966004
(9Z)-5-buta-1,3-dien-2-yl-N-methyl-4-(3-methylbutan-2-ylideneamino)-8-methylideneundeca-1,9-dien-2-amine (PubChem CID 166966004) has the molecular formula C22H36N2 and a molecular weight of 328.54 g/mol. Its IUPAC name is (9Z)-5-buta-1,3-dien-2-yl-N-methyl-4-(3-methylbutan-2-ylideneamino)-8-methylideneundeca-1,9-dien-2-amine.
| Compound Name | (9Z)-5-buta-1,3-dien-2-yl-N-methyl-4-(3-methylbutan-2-ylideneamino)-8-methylideneundeca-1,9-dien-2-amine |
|---|---|
| PubChem CID | 166966004 |
| Molecular Formula | C22H36N2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | (9Z)-5-buta-1,3-dien-2-yl-N-methyl-4-(3-methylbutan-2-ylideneamino)-8-methylideneundeca-1,9-dien-2-amine |
| SMILES | C=CC(=C)C(CCC(=C)/C=C\C)C(CC(=C)NC)/N=C(\C)C(C)C |
| InChI | InChI=1S/C22H36N2/c1-10-12-17(5)13-14-21(18(6)11-2)22(15-19(7)23-9)24-20(8)16(3)4/h10-12,16,21-23H,2,5-7,13-15H2,1,3-4,8-9H3/b12-10-,24-20+ |
| InChIKey | HBQNOICFIIVEJQ-PMUISYBUSA-N |
| XLogP | 5.87 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|