C24H26N4O3 — CID 166966040
methyl 3-(1H-indol-3-yl)-2-[[3-(1H-indol-3-yl)-2-(methylamino)propanoyl]amino]propanoate (PubChem CID 166966040) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is methyl 3-(1H-indol-3-yl)-2-[[3-(1H-indol-3-yl)-2-(methylamino)propanoyl]amino]propanoate.
| Compound Name | methyl 3-(1H-indol-3-yl)-2-[[3-(1H-indol-3-yl)-2-(methylamino)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 166966040 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | methyl 3-(1H-indol-3-yl)-2-[[3-(1H-indol-3-yl)-2-(methylamino)propanoyl]amino]propanoate |
| SMILES | CNC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)OC |
| InChI | InChI=1S/C24H26N4O3/c1-25-21(11-15-13-26-19-9-5-3-7-17(15)19)23(29)28-22(24(30)31-2)12-16-14-27-20-10-6-4-8-18(16)20/h3-10,13-14,21-22,25-27H,11-12H2,1-2H3,(H,28,29) |
| InChIKey | ZICTWGUCUUCHKI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |