C17H35N — CID 166966108
N-but-1-en-2-yl-2,3,5,7,7-pentamethyloctan-4-amine (PubChem CID 166966108) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is N-but-1-en-2-yl-2,3,5,7,7-pentamethyloctan-4-amine.
| Compound Name | N-but-1-en-2-yl-2,3,5,7,7-pentamethyloctan-4-amine |
|---|---|
| PubChem CID | 166966108 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | N-but-1-en-2-yl-2,3,5,7,7-pentamethyloctan-4-amine |
| SMILES | C=C(CC)NC(C(C)CC(C)(C)C)C(C)C(C)C |
| InChI | InChI=1S/C17H35N/c1-10-14(5)18-16(15(6)12(2)3)13(4)11-17(7,8)9/h12-13,15-16,18H,5,10-11H2,1-4,6-9H3 |
| InChIKey | TXGRDSBMRFJNMG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |