C21H23F2N5O3 — CID 166966506
[5-[6-(3-butoxyazetidin-1-yl)-5-fluoro-3-pyridinyl]-6-fluorocyclohexa-1,5-dien-3-yn-1-yl]methyl N-(diaminomethylidene)carbamate (PubChem CID 166966506) has the molecular formula C21H23F2N5O3 and a molecular weight of 431.44 g/mol. Its IUPAC name is [5-[6-(3-butoxyazetidin-1-yl)-5-fluoro-3-pyridinyl]-6-fluorocyclohexa-1,5-dien-3-yn-1-yl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [5-[6-(3-butoxyazetidin-1-yl)-5-fluoro-3-pyridinyl]-6-fluorocyclohexa-1,5-dien-3-yn-1-yl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 166966506 |
| Molecular Formula | C21H23F2N5O3 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [5-[6-(3-butoxyazetidin-1-yl)-5-fluoro-3-pyridinyl]-6-fluorocyclohexa-1,5-dien-3-yn-1-yl]methyl N-(diaminomethylidene)carbamate |
| SMILES | CCCCOC1CN(c2ncc(-c3c#ccc(COC(=O)N=C(N)N)c3F)cc2F)C1 |
| InChI | InChI=1S/C21H23F2N5O3/c1-2-3-7-30-15-10-28(11-15)19-17(22)8-14(9-26-19)16-6-4-5-13(18(16)23)12-31-21(29)27-20(24)25/h5,8-9,15H,2-3,7,10-12H2,1H3,(H4,24,25,27,29) |
| InChIKey | SJLTVJQCPSDJCM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|