C12H21NO — CID 166966629
(4Z,6Z)-2-methoxy-N,6-dimethylnona-4,6,8-trien-1-amine (PubChem CID 166966629) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (4Z,6Z)-2-methoxy-N,6-dimethylnona-4,6,8-trien-1-amine.
| Compound Name | (4Z,6Z)-2-methoxy-N,6-dimethylnona-4,6,8-trien-1-amine |
|---|---|
| PubChem CID | 166966629 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (4Z,6Z)-2-methoxy-N,6-dimethylnona-4,6,8-trien-1-amine |
| SMILES | C=C/C=C(C)\C=C/CC(CNC)OC |
| InChI | InChI=1S/C12H21NO/c1-5-7-11(2)8-6-9-12(14-4)10-13-3/h5-8,12-13H,1,9-10H2,2-4H3/b8-6-,11-7- |
| InChIKey | RMLWBEYHTMRHES-NFNKYSHCSA-N |
| XLogP | 2.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|