C28H64O4Si2Sn2 — CID 16696676
4,4,8,8-tetratert-butyl-2,2,6,6-tetra(propan-2-yl)-1,3,5,7,2,6,4,8-tetraoxadisiladistannocane (PubChem CID 16696676) has the molecular formula C28H64O4Si2Sn2 and a molecular weight of 758.41 g/mol. Its IUPAC name is 4,4,8,8-tetratert-butyl-2,2,6,6-tetra(propan-2-yl)-1,3,5,7,2,6,4,8-tetraoxadisiladistannocane.
| Compound Name | 4,4,8,8-tetratert-butyl-2,2,6,6-tetra(propan-2-yl)-1,3,5,7,2,6,4,8-tetraoxadisiladistannocane |
|---|---|
| PubChem CID | 16696676 |
| Molecular Formula | C28H64O4Si2Sn2 |
| Molecular Weight | 758.41 g/mol |
| Exact Mass | 760.24 |
| IUPAC Name | 4,4,8,8-tetratert-butyl-2,2,6,6-tetra(propan-2-yl)-1,3,5,7,2,6,4,8-tetraoxadisiladistannocane |
| SMILES | CC(C)[Si]1(C(C)C)O[Sn](C(C)(C)C)(C(C)(C)C)O[Si](C(C)C)(C(C)C)O[Sn](C(C)(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/2C6H14O2Si.4C4H9.2Sn/c2*1-5(2)9(7,8)6(3)4;4*1-4(2)3;;/h2*5-6H,1-4H3;4*1-3H3;;/q2*-2;;;;;2*+2 |
| InChIKey | JQYADQWYBHAWAA-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.41 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|