About methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate
methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate (PubChem CID 166967233) has the molecular formula C14H15F2NO3
and a molecular weight of 283.27 g/mol. Its IUPAC name is methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate |
| PubChem CID | 166967233 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate |
| SMILES | C/C=C(/NC(=O)c1ccc(C(C)(F)F)cc1)C(=O)OC |
| InChI | InChI=1S/C14H15F2NO3/c1-4-11(13(19)20-3)17-12(18)9-5-7-10(8-6-9)14(2,15)16/h4-8H,1-3H3,(H,17,18)/b11-4+ |
| InChIKey | AZDAVBNFVRPXMJ-NYYWCZLTSA-N |
| XLogP | 2.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate?
The IUPAC name of methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate (CID 166967233) is methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate.
What is the SMILES notation for methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate?
The canonical SMILES for methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate is C/C=C(/NC(=O)c1ccc(C(C)(F)F)cc1)C(=O)OC.
What is the InChIKey of methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate?
The InChIKey is AZDAVBNFVRPXMJ-NYYWCZLTSA-N. The full InChI is InChI=1S/C14H15F2NO3/c1-4-11(13(19)20-3)17-12(18)9-5-7-10(8-6-9)14(2,15)16/h4-8H,1-3H3,(H,17,18)/b11-4+.
What are the key properties of methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate?
methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate has a molecular weight of 283.27 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-2-[[4-(1,1-difluoroethyl)benzoyl]amino]but-2-enoate is sourced from PubChem (CID 166967233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).