About 2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one
2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one (PubChem CID 166967241) has the molecular formula C12H9F2NO2
and a molecular weight of 237.20 g/mol. Its IUPAC name is 2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one |
| PubChem CID | 166967241 |
| Molecular Formula | C12H9F2NO2 |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one |
| SMILES | C=C1N=C(c2ccc(C(C)(F)F)cc2)OC1=O |
| InChI | InChI=1S/C12H9F2NO2/c1-7-11(16)17-10(15-7)8-3-5-9(6-4-8)12(2,13)14/h3-6H,1H2,2H3 |
| InChIKey | XBEDKDJXVSIKTQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one?
The IUPAC name of 2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one (CID 166967241) is 2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one.
What is the SMILES notation for 2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one?
The canonical SMILES for 2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one is C=C1N=C(c2ccc(C(C)(F)F)cc2)OC1=O.
What is the InChIKey of 2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one?
The InChIKey is XBEDKDJXVSIKTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F2NO2/c1-7-11(16)17-10(15-7)8-3-5-9(6-4-8)12(2,13)14/h3-6H,1H2,2H3.
What are the key properties of 2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one?
2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one has a molecular weight of 237.20 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,1-difluoroethyl)phenyl]-4-methylidene-1,3-oxazol-5-one is sourced from PubChem (CID 166967241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).