About N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide
N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide (PubChem CID 166967437) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide.
Molecular Properties
| Compound Name | N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide |
| PubChem CID | 166967437 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide |
| SMILES | C=C/C=C\C(=C/C)CNC(=O)CCOC |
| InChI | InChI=1S/C12H19NO2/c1-4-6-7-11(5-2)10-13-12(14)8-9-15-3/h4-7H,1,8-10H2,2-3H3,(H,13,14)/b7-6-,11-5+ |
| InChIKey | JJQQVWARJSYMMX-TUKAJDRUSA-N |
| XLogP | 1.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide?
The IUPAC name of N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide (CID 166967437) is N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide.
What is the SMILES notation for N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide?
The canonical SMILES for N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide is C=C/C=C\C(=C/C)CNC(=O)CCOC.
What is the InChIKey of N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide?
The InChIKey is JJQQVWARJSYMMX-TUKAJDRUSA-N. The full InChI is InChI=1S/C12H19NO2/c1-4-6-7-11(5-2)10-13-12(14)8-9-15-3/h4-7H,1,8-10H2,2-3H3,(H,13,14)/b7-6-,11-5+.
What are the key properties of N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide?
N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide has a molecular weight of 209.29 g/mol, XLogP of 1.83, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxypropanamide is sourced from PubChem (CID 166967437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).