About (2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate
(2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate (PubChem CID 166967522) has the molecular formula C12H17FO3
and a molecular weight of 228.26 g/mol. Its IUPAC name is (2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate.
Molecular Properties
| Compound Name | (2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate |
| PubChem CID | 166967522 |
| Molecular Formula | C12H17FO3 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate |
| SMILES | COCCC(=O)OCC1=C(F)CC(C)C=C1 |
| InChI | InChI=1S/C12H17FO3/c1-9-3-4-10(11(13)7-9)8-16-12(14)5-6-15-2/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | WEYBQMHRJWSWHU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate?
The IUPAC name of (2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate (CID 166967522) is (2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate.
What is the SMILES notation for (2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate?
The canonical SMILES for (2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate is COCCC(=O)OCC1=C(F)CC(C)C=C1.
What is the InChIKey of (2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate?
The InChIKey is WEYBQMHRJWSWHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17FO3/c1-9-3-4-10(11(13)7-9)8-16-12(14)5-6-15-2/h3-4,9H,5-8H2,1-2H3.
What are the key properties of (2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate?
(2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate has a molecular weight of 228.26 g/mol, XLogP of 2.39, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl 3-methoxypropanoate is sourced from PubChem (CID 166967522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).