C36H40N6O5 — CID 166967649
1-(2,4-dimethoxyphenyl)-3-(2,6-dimethylcyclohexa-1,5-dien-3-yn-1-yl)-7-[3,5-dimethyl-4-(2-morpholin-4-ylethoxy)anilino]-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 166967649) has the molecular formula C36H40N6O5 and a molecular weight of 636.75 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-(2,6-dimethylcyclohexa-1,5-dien-3-yn-1-yl)-7-[3,5-dimethyl-4-(2-morpholin-4-ylethoxy)anilino]-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-(2,6-dimethylcyclohexa-1,5-dien-3-yn-1-yl)-7-[3,5-dimethyl-4-(2-morpholin-4-ylethoxy)anilino]-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 166967649 |
| Molecular Formula | C36H40N6O5 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.31 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-(2,6-dimethylcyclohexa-1,5-dien-3-yn-1-yl)-7-[3,5-dimethyl-4-(2-morpholin-4-ylethoxy)anilino]-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | COc1ccc(N2C(=O)N(c3c(C)c#ccc3C)Cc3cnc(Nc4cc(C)c(OCCN5CCOCC5)c(C)c4)nc32)c(OC)c1 |
| InChI | InChI=1S/C36H40N6O5/c1-23-8-7-9-24(2)32(23)41-22-27-21-37-35(39-34(27)42(36(41)43)30-11-10-29(44-5)20-31(30)45-6)38-28-18-25(3)33(26(4)19-28)47-17-14-40-12-15-46-16-13-40/h8,10-11,18-21H,12-17,22H2,1-6H3,(H,37,38,39) |
| InChIKey | CXFNZRYDYMLFTI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |