C14H17N5 — CID 166967961
12-[(2S)-3,4-dimethylpent-4-en-2-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 166967961) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is 12-[(2S)-3,4-dimethylpent-4-en-2-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 12-[(2S)-3,4-dimethylpent-4-en-2-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 166967961 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 12-[(2S)-3,4-dimethylpent-4-en-2-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | C=C(C)C(C)[C@H](C)c1nnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C14H17N5/c1-8(2)9(3)10(4)14-18-17-12-7-16-13-11(19(12)14)5-6-15-13/h5-7,9-10,15H,1H2,2-4H3/t9?,10-/m0/s1 |
| InChIKey | WLHBAHDJFLHKMD-AXDSSHIGSA-N |
| XLogP | 2.92 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|