C26H53FN2 — CID 166967998
4-N-ethyl-10-fluoro-2,7,10-trimethyl-1-N-(2-methylhexan-3-yl)-1-N-prop-2-enylundecane-1,4-diamine (PubChem CID 166967998) has the molecular formula C26H53FN2 and a molecular weight of 412.72 g/mol. Its IUPAC name is 4-N-ethyl-10-fluoro-2,7,10-trimethyl-1-N-(2-methylhexan-3-yl)-1-N-prop-2-enylundecane-1,4-diamine.
| Compound Name | 4-N-ethyl-10-fluoro-2,7,10-trimethyl-1-N-(2-methylhexan-3-yl)-1-N-prop-2-enylundecane-1,4-diamine |
|---|---|
| PubChem CID | 166967998 |
| Molecular Formula | C26H53FN2 |
| Molecular Weight | 412.72 g/mol |
| Exact Mass | 412.42 |
| IUPAC Name | 4-N-ethyl-10-fluoro-2,7,10-trimethyl-1-N-(2-methylhexan-3-yl)-1-N-prop-2-enylundecane-1,4-diamine |
| SMILES | C=CCN(CC(C)CC(CCC(C)CCC(C)(C)F)NCC)C(CCC)C(C)C |
| InChI | InChI=1S/C26H53FN2/c1-10-13-25(21(4)5)29(18-11-2)20-23(7)19-24(28-12-3)15-14-22(6)16-17-26(8,9)27/h11,21-25,28H,2,10,12-20H2,1,3-9H3 |
| InChIKey | NJLQHSBZURWKNG-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.72 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|