C21H25N5O3S — CID 166968014
2-ethyl-4-hydroxy-N'-[5-(4-methylphenyl)sulfinylpyrrolo[2,3-b]pyrazin-2-yl]cyclopentane-1-carbohydrazide (PubChem CID 166968014) has the molecular formula C21H25N5O3S and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-ethyl-4-hydroxy-N'-[5-(4-methylphenyl)sulfinylpyrrolo[2,3-b]pyrazin-2-yl]cyclopentane-1-carbohydrazide.
| Compound Name | 2-ethyl-4-hydroxy-N'-[5-(4-methylphenyl)sulfinylpyrrolo[2,3-b]pyrazin-2-yl]cyclopentane-1-carbohydrazide |
|---|---|
| PubChem CID | 166968014 |
| Molecular Formula | C21H25N5O3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 2-ethyl-4-hydroxy-N'-[5-(4-methylphenyl)sulfinylpyrrolo[2,3-b]pyrazin-2-yl]cyclopentane-1-carbohydrazide |
| SMILES | CCC1CC(O)CC1C(=O)NNc1cnc2c(ccn2S(=O)c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C21H25N5O3S/c1-3-14-10-15(27)11-17(14)21(28)25-24-19-12-22-20-18(23-19)8-9-26(20)30(29)16-6-4-13(2)5-7-16/h4-9,12,14-15,17,27H,3,10-11H2,1-2H3,(H,23,24)(H,25,28) |
| InChIKey | CLPYWKHJRXNVEZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|