C15H23N5O — CID 166968409
(2Z)-3-imino-1-(4-methylpiperazin-1-yl)-2-(1,4,6-trimethylpyrimidin-2-ylidene)propan-1-one (PubChem CID 166968409) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is (2Z)-3-imino-1-(4-methylpiperazin-1-yl)-2-(1,4,6-trimethylpyrimidin-2-ylidene)propan-1-one.
| Compound Name | (2Z)-3-imino-1-(4-methylpiperazin-1-yl)-2-(1,4,6-trimethylpyrimidin-2-ylidene)propan-1-one |
|---|---|
| PubChem CID | 166968409 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | (2Z)-3-imino-1-(4-methylpiperazin-1-yl)-2-(1,4,6-trimethylpyrimidin-2-ylidene)propan-1-one |
| SMILES | [H]/N=C/C(C(=O)N1CCN(C)CC1)=C1/N=C(C)C=C(C)N1C |
| InChI | InChI=1S/C15H23N5O/c1-11-9-12(2)19(4)14(17-11)13(10-16)15(21)20-7-5-18(3)6-8-20/h9-10,16H,5-8H2,1-4H3/b14-13+,16-10+ |
| InChIKey | PRSGOCVSXYRXDY-KSPDVFMOSA-N |
| XLogP | 0.93 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|