C47H33N5 — CID 166968520
9-[4-(9H-carbazol-1-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-dimethylcarbazole (PubChem CID 166968520) has the molecular formula C47H33N5 and a molecular weight of 667.82 g/mol. Its IUPAC name is 9-[4-(9H-carbazol-1-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-dimethylcarbazole.
| Compound Name | 9-[4-(9H-carbazol-1-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-dimethylcarbazole |
|---|---|
| PubChem CID | 166968520 |
| Molecular Formula | C47H33N5 |
| Molecular Weight | 667.82 g/mol |
| Exact Mass | 667.27 |
| IUPAC Name | 9-[4-(9H-carbazol-1-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-dimethylcarbazole |
| SMILES | Cc1ccc2c3ccc(C)cc3n(-c3ccc(-c4cccc5c4[nH]c4ccccc45)cc3-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2c1 |
| InChI | InChI=1S/C47H33N5/c1-29-20-23-36-37-24-21-30(2)27-43(37)52(42(36)26-29)41-25-22-33(34-17-11-18-38-35-16-9-10-19-40(35)48-44(34)38)28-39(41)47-50-45(31-12-5-3-6-13-31)49-46(51-47)32-14-7-4-8-15-32/h3-28,48H,1-2H3 |
| InChIKey | YQAXAYNILNNANB-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.82 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |