C23H23F3N6 — CID 166968719
4-[5-methyl-4-(trifluoromethyl)-1,4-dihydrotriazol-5-yl]-2-[1-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]imidazol-4-yl]pyridine (PubChem CID 166968719) has the molecular formula C23H23F3N6 and a molecular weight of 440.47 g/mol. Its IUPAC name is 4-[5-methyl-4-(trifluoromethyl)-1,4-dihydrotriazol-5-yl]-2-[1-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]imidazol-4-yl]pyridine.
| Compound Name | 4-[5-methyl-4-(trifluoromethyl)-1,4-dihydrotriazol-5-yl]-2-[1-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]imidazol-4-yl]pyridine |
|---|---|
| PubChem CID | 166968719 |
| Molecular Formula | C23H23F3N6 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 4-[5-methyl-4-(trifluoromethyl)-1,4-dihydrotriazol-5-yl]-2-[1-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]imidazol-4-yl]pyridine |
| SMILES | CC1(c2ccnc(-c3cn(C[C@H]4CCCc5ccccc54)cn3)c2)NN=NC1C(F)(F)F |
| InChI | InChI=1S/C23H23F3N6/c1-22(21(23(24,25)26)29-31-30-22)17-9-10-27-19(11-17)20-13-32(14-28-20)12-16-7-4-6-15-5-2-3-8-18(15)16/h2-3,5,8-11,13-14,16,21H,4,6-7,12H2,1H3,(H,29,30)/t16-,21?,22?/m1/s1 |
| InChIKey | WJZXXUCNRLLPBO-NYYVNYEXSA-N |
| XLogP | 5.18 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |