C27H26N4O2 — CID 166968967
1-[3-[8-methyl-1-(4-phenoxyphenyl)-7,8-dihydroimidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one (PubChem CID 166968967) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-[3-[8-methyl-1-(4-phenoxyphenyl)-7,8-dihydroimidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[3-[8-methyl-1-(4-phenoxyphenyl)-7,8-dihydroimidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 166968967 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-[3-[8-methyl-1-(4-phenoxyphenyl)-7,8-dihydroimidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCC(c2nc(-c3ccc(Oc4ccccc4)cc3)c3n2C=CNC3C)C1 |
| InChI | InChI=1S/C27H26N4O2/c1-3-7-24(32)30-16-14-21(18-30)27-29-25(26-19(2)28-15-17-31(26)27)20-10-12-23(13-11-20)33-22-8-5-4-6-9-22/h4-6,8-13,15,17,19,21,28H,14,16,18H2,1-2H3 |
| InChIKey | SDPBNUKLKKLBAS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|