C29H30ClF3N2O2 — CID 166969035
3-amino-1-[4-[4-[(2-chloro-4-methylphenyl)methyl]phenoxy]piperidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 166969035) has the molecular formula C29H30ClF3N2O2 and a molecular weight of 531.02 g/mol. Its IUPAC name is 3-amino-1-[4-[4-[(2-chloro-4-methylphenyl)methyl]phenoxy]piperidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 3-amino-1-[4-[4-[(2-chloro-4-methylphenyl)methyl]phenoxy]piperidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 166969035 |
| Molecular Formula | C29H30ClF3N2O2 |
| Molecular Weight | 531.02 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 3-amino-1-[4-[4-[(2-chloro-4-methylphenyl)methyl]phenoxy]piperidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | Cc1ccc(Cc2ccc(OC3CCN(C(=O)CC(N)Cc4cc(F)c(F)cc4F)CC3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C29H30ClF3N2O2/c1-18-2-5-20(25(30)12-18)13-19-3-6-23(7-4-19)37-24-8-10-35(11-9-24)29(36)16-22(34)14-21-15-27(32)28(33)17-26(21)31/h2-7,12,15,17,22,24H,8-11,13-14,16,34H2,1H3 |
| InChIKey | GADFQHADCQINDK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.02 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|