C15H29N — CID 166969577
(6Z)-9-ethyl-1,4,4,9-tetramethyl-3,5,8,10-tetrahydro-2H-azecine (PubChem CID 166969577) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is (6Z)-9-ethyl-1,4,4,9-tetramethyl-3,5,8,10-tetrahydro-2H-azecine.
| Compound Name | (6Z)-9-ethyl-1,4,4,9-tetramethyl-3,5,8,10-tetrahydro-2H-azecine |
|---|---|
| PubChem CID | 166969577 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | (6Z)-9-ethyl-1,4,4,9-tetramethyl-3,5,8,10-tetrahydro-2H-azecine |
| SMILES | CCC1(C)C/C=C\CC(C)(C)CCN(C)C1 |
| InChI | InChI=1S/C15H29N/c1-6-15(4)10-8-7-9-14(2,3)11-12-16(5)13-15/h7-8H,6,9-13H2,1-5H3/b8-7- |
| InChIKey | SDOVNASYEVHMNI-FPLPWBNLSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|