C14H25N — CID 166969590
3,3,4,4,5-pentamethyl-N-prop-2-enylhexa-1,5-dien-2-amine (PubChem CID 166969590) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 3,3,4,4,5-pentamethyl-N-prop-2-enylhexa-1,5-dien-2-amine.
| Compound Name | 3,3,4,4,5-pentamethyl-N-prop-2-enylhexa-1,5-dien-2-amine |
|---|---|
| PubChem CID | 166969590 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 3,3,4,4,5-pentamethyl-N-prop-2-enylhexa-1,5-dien-2-amine |
| SMILES | C=CCNC(=C)C(C)(C)C(C)(C)C(=C)C |
| InChI | InChI=1S/C14H25N/c1-9-10-15-12(4)14(7,8)13(5,6)11(2)3/h9,15H,1-2,4,10H2,3,5-8H3 |
| InChIKey | RTUMGYZUMYGALN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|