C22H37N — CID 166969757
N-[(3E,8Z)-2,6,11-trimethyl-4-(3-methylbutyl)dodeca-1,3,8,10-tetraen-3-yl]ethanimine (PubChem CID 166969757) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is N-[(3E,8Z)-2,6,11-trimethyl-4-(3-methylbutyl)dodeca-1,3,8,10-tetraen-3-yl]ethanimine.
| Compound Name | N-[(3E,8Z)-2,6,11-trimethyl-4-(3-methylbutyl)dodeca-1,3,8,10-tetraen-3-yl]ethanimine |
|---|---|
| PubChem CID | 166969757 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | N-[(3E,8Z)-2,6,11-trimethyl-4-(3-methylbutyl)dodeca-1,3,8,10-tetraen-3-yl]ethanimine |
| SMILES | C=C(C)C(/N=C/C)=C(/CCC(C)C)CC(C)C/C=C\C=C(C)C |
| InChI | InChI=1S/C22H37N/c1-9-23-22(19(6)7)21(15-14-18(4)5)16-20(8)13-11-10-12-17(2)3/h9-12,18,20H,6,13-16H2,1-5,7-8H3/b11-10-,22-21+,23-9+ |
| InChIKey | VVLUIUPINUWLOE-LKCHPOGFSA-N |
| XLogP | 7.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|