C29H45N7O — CID 166969763
1-(1-cyclononyl-1,2,3,4-tetrahydroisoquinolin-3-yl)-3-[4-[3-(dimethylamino)propylamino]-6-methylpyrimidin-2-yl]urea (PubChem CID 166969763) has the molecular formula C29H45N7O and a molecular weight of 507.73 g/mol. Its IUPAC name is 1-(1-cyclononyl-1,2,3,4-tetrahydroisoquinolin-3-yl)-3-[4-[3-(dimethylamino)propylamino]-6-methylpyrimidin-2-yl]urea.
| Compound Name | 1-(1-cyclononyl-1,2,3,4-tetrahydroisoquinolin-3-yl)-3-[4-[3-(dimethylamino)propylamino]-6-methylpyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 166969763 |
| Molecular Formula | C29H45N7O |
| Molecular Weight | 507.73 g/mol |
| Exact Mass | 507.37 |
| IUPAC Name | 1-(1-cyclononyl-1,2,3,4-tetrahydroisoquinolin-3-yl)-3-[4-[3-(dimethylamino)propylamino]-6-methylpyrimidin-2-yl]urea |
| SMILES | Cc1cc(NCCCN(C)C)nc(NC(=O)NC2Cc3ccccc3C(C3CCCCCCCC3)N2)n1 |
| InChI | InChI=1S/C29H45N7O/c1-21-19-25(30-17-12-18-36(2)3)33-28(31-21)35-29(37)34-26-20-23-15-10-11-16-24(23)27(32-26)22-13-8-6-4-5-7-9-14-22/h10-11,15-16,19,22,26-27,32H,4-9,12-14,17-18,20H2,1-3H3,(H3,30,31,33,34,35,37) |
| InChIKey | WGELVUIKDJUONY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.73 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|