C24H49NO4 — CID 166970083
3,3-dimethyldecan-2-yl N-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]carbamate (PubChem CID 166970083) has the molecular formula C24H49NO4 and a molecular weight of 415.66 g/mol. Its IUPAC name is 3,3-dimethyldecan-2-yl N-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]carbamate.
| Compound Name | 3,3-dimethyldecan-2-yl N-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 166970083 |
| Molecular Formula | C24H49NO4 |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 415.37 |
| IUPAC Name | 3,3-dimethyldecan-2-yl N-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]carbamate |
| SMILES | CCCCCCCC(C)(C)C(C)OC(=O)NCCC(C)(C)OCCC(C)(C)OC |
| InChI | InChI=1S/C24H49NO4/c1-10-11-12-13-14-15-22(3,4)20(2)29-21(26)25-18-16-24(7,8)28-19-17-23(5,6)27-9/h20H,10-19H2,1-9H3,(H,25,26) |
| InChIKey | HALIDGCMNZMRMP-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|